C16H26N2O3 — CID 70341809
(3S)-1-[2-(2,2-dimethoxyethylamino)-2-phenylethyl]pyrrolidin-3-ol (PubChem CID 70341809) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is (3S)-1-[2-(2,2-dimethoxyethylamino)-2-phenylethyl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[2-(2,2-dimethoxyethylamino)-2-phenylethyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 70341809 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (3S)-1-[2-(2,2-dimethoxyethylamino)-2-phenylethyl]pyrrolidin-3-ol |
| SMILES | COC(CNC(CN1CC[C@H](O)C1)c1ccccc1)OC |
| InChI | InChI=1S/C16H26N2O3/c1-20-16(21-2)10-17-15(13-6-4-3-5-7-13)12-18-9-8-14(19)11-18/h3-7,14-17,19H,8-12H2,1-2H3/t14-,15?/m0/s1 |
| InChIKey | YCWPPURKEMRUQT-MLCCFXAWSA-N |
| XLogP | 1.00 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|