C30H37F3IN3O4 — CID 70341822
N-[4-[(2,2-difluoro-3-methylbutyl)-[1-iodo-2-oxo-2-(prop-2-enylamino)ethyl]amino]-1-(3-fluorophenyl)-3-hydroxypent-4-en-2-yl]-3-hydroxy-2,5-dimethylbenzamide (PubChem CID 70341822) has the molecular formula C30H37F3IN3O4 and a molecular weight of 687.54 g/mol. Its IUPAC name is N-[4-[(2,2-difluoro-3-methylbutyl)-[1-iodo-2-oxo-2-(prop-2-enylamino)ethyl]amino]-1-(3-fluorophenyl)-3-hydroxypent-4-en-2-yl]-3-hydroxy-2,5-dimethylbenzamide.
| Compound Name | N-[4-[(2,2-difluoro-3-methylbutyl)-[1-iodo-2-oxo-2-(prop-2-enylamino)ethyl]amino]-1-(3-fluorophenyl)-3-hydroxypent-4-en-2-yl]-3-hydroxy-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 70341822 |
| Molecular Formula | C30H37F3IN3O4 |
| Molecular Weight | 687.54 g/mol |
| Exact Mass | 687.18 |
| IUPAC Name | N-[4-[(2,2-difluoro-3-methylbutyl)-[1-iodo-2-oxo-2-(prop-2-enylamino)ethyl]amino]-1-(3-fluorophenyl)-3-hydroxypent-4-en-2-yl]-3-hydroxy-2,5-dimethylbenzamide |
| SMILES | C=CCNC(=O)C(I)N(CC(F)(F)C(C)C)C(=C)C(O)C(Cc1cccc(F)c1)NC(=O)c1cc(C)cc(O)c1C |
| InChI | InChI=1S/C30H37F3IN3O4/c1-7-11-35-29(41)27(34)37(16-30(32,33)17(2)3)20(6)26(39)24(15-21-9-8-10-22(31)14-21)36-28(40)23-12-18(4)13-25(38)19(23)5/h7-10,12-14,17,24,26-27,38-39H,1,6,11,15-16H2,2-5H3,(H,35,41)(H,36,40) |
| InChIKey | LKZODDGKIZRDED-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|