About 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole
4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole (PubChem CID 70342301) has the molecular formula C20H20ClN5O
and a molecular weight of 381.87 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole |
| PubChem CID | 70342301 |
| Molecular Formula | C20H20ClN5O |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole |
| SMILES | Cc1nccn1-c1nc(-c2ccc(Cl)cc2)c(CCCCc2ncc[nH]2)o1 |
| InChI | InChI=1S/C20H20ClN5O/c1-14-22-12-13-26(14)20-25-19(15-6-8-16(21)9-7-15)17(27-20)4-2-3-5-18-23-10-11-24-18/h6-13H,2-5H2,1H3,(H,23,24) |
| InChIKey | UTCJYASQDQMGGM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole?
The IUPAC name of 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole (CID 70342301) is 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole.
What is the SMILES notation for 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole?
The canonical SMILES for 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole is Cc1nccn1-c1nc(-c2ccc(Cl)cc2)c(CCCCc2ncc[nH]2)o1.
What is the InChIKey of 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole?
The InChIKey is UTCJYASQDQMGGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClN5O/c1-14-22-12-13-26(14)20-25-19(15-6-8-16(21)9-7-15)17(27-20)4-2-3-5-18-23-10-11-24-18/h6-13H,2-5H2,1H3,(H,23,24).
What are the key properties of 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole?
4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole has a molecular weight of 381.87 g/mol, XLogP of 4.78, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-5-[4-(1H-imidazol-2-yl)butyl]-2-(2-methylimidazol-1-yl)-1,3-oxazole is sourced from PubChem (CID 70342301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).