C14H16Cl2N2O4S — CID 70342438
3,3-dichloro-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indol-2-one (PubChem CID 70342438) has the molecular formula C14H16Cl2N2O4S and a molecular weight of 379.27 g/mol. Its IUPAC name is 3,3-dichloro-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indol-2-one.
| Compound Name | 3,3-dichloro-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indol-2-one |
|---|---|
| PubChem CID | 70342438 |
| Molecular Formula | C14H16Cl2N2O4S |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 3,3-dichloro-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indol-2-one |
| SMILES | COC[C@@H]1CCCN1S(=O)(=O)c1ccc2c(c1)C(Cl)(Cl)C(=O)N2 |
| InChI | InChI=1S/C14H16Cl2N2O4S/c1-22-8-9-3-2-6-18(9)23(20,21)10-4-5-12-11(7-10)14(15,16)13(19)17-12/h4-5,7,9H,2-3,6,8H2,1H3,(H,17,19)/t9-/m0/s1 |
| InChIKey | IYAIZQNPIDEZTD-VIFPVBQESA-N |
| XLogP | 2.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|