C13H14O2 — CID 70342812
2,3,4a,5,5a,6-hexahydrobenzo[g]chromen-4-one (PubChem CID 70342812) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2,3,4a,5,5a,6-hexahydrobenzo[g]chromen-4-one.
| Compound Name | 2,3,4a,5,5a,6-hexahydrobenzo[g]chromen-4-one |
|---|---|
| PubChem CID | 70342812 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2,3,4a,5,5a,6-hexahydrobenzo[g]chromen-4-one |
| SMILES | O=C1CCOC2=CC3=CC=CCC3CC12 |
| InChI | InChI=1S/C13H14O2/c14-12-5-6-15-13-8-10-4-2-1-3-9(10)7-11(12)13/h1-2,4,8-9,11H,3,5-7H2 |
| InChIKey | YSWKSWPMLBLPLR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |