About 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride
1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride (PubChem CID 70342986) has the molecular formula C8H15ClN2O2
and a molecular weight of 206.67 g/mol. Its IUPAC name is 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride |
| PubChem CID | 70342986 |
| Molecular Formula | C8H15ClN2O2 |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride |
| SMILES | CCCN1C=NCC(C(=O)O)C1.Cl |
| InChI | InChI=1S/C8H14N2O2.ClH/c1-2-3-10-5-7(8(11)12)4-9-6-10;/h6-7H,2-5H2,1H3,(H,11,12);1H |
| InChIKey | CSDBLHOZJOBTHS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride?
The IUPAC name of 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride (CID 70342986) is 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride.
What is the SMILES notation for 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride?
The canonical SMILES for 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride is CCCN1C=NCC(C(=O)O)C1.Cl.
What is the InChIKey of 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride?
The InChIKey is CSDBLHOZJOBTHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2.ClH/c1-2-3-10-5-7(8(11)12)4-9-6-10;/h6-7H,2-5H2,1H3,(H,11,12);1H.
What are the key properties of 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride?
1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride has a molecular weight of 206.67 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-5,6-dihydro-4H-pyrimidine-5-carboxylic acid;hydrochloride is sourced from PubChem (CID 70342986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).