About (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine
(4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine (PubChem CID 70343153) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine.
Molecular Properties
| Compound Name | (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine |
| PubChem CID | 70343153 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine |
| SMILES | N[C@H]1CN(C2Oc3ccccc3O2)CN1 |
| InChI | InChI=1S/C10H13N3O2/c11-9-5-13(6-12-9)10-14-7-3-1-2-4-8(7)15-10/h1-4,9-10,12H,5-6,11H2/t9-/m1/s1 |
| InChIKey | WVXYSBMZPMBBCS-SECBINFHSA-N |
| XLogP | -0.11 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine?
The IUPAC name of (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine (CID 70343153) is (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine.
What is the SMILES notation for (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine?
The canonical SMILES for (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine is N[C@H]1CN(C2Oc3ccccc3O2)CN1.
What is the InChIKey of (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine?
The InChIKey is WVXYSBMZPMBBCS-SECBINFHSA-N. The full InChI is InChI=1S/C10H13N3O2/c11-9-5-13(6-12-9)10-14-7-3-1-2-4-8(7)15-10/h1-4,9-10,12H,5-6,11H2/t9-/m1/s1.
What are the key properties of (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine?
(4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine has a molecular weight of 207.23 g/mol, XLogP of -0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-(1,3-benzodioxol-2-yl)imidazolidin-4-amine is sourced from PubChem (CID 70343153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).