C8H17NO — CID 70343666
N,2,6-trimethyloxan-4-amine (PubChem CID 70343666) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is N,2,6-trimethyloxan-4-amine.
| Compound Name | N,2,6-trimethyloxan-4-amine |
|---|---|
| PubChem CID | 70343666 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | N,2,6-trimethyloxan-4-amine |
| SMILES | CNC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C8H17NO/c1-6-4-8(9-3)5-7(2)10-6/h6-9H,4-5H2,1-3H3 |
| InChIKey | LTFZSDZHUIFZIZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |