C8H7F5N2 — CID 70343798
2-methyl-5-(1,1,3,3,3-pentafluoropropyl)pyrazine (PubChem CID 70343798) has the molecular formula C8H7F5N2 and a molecular weight of 226.15 g/mol. Its IUPAC name is 2-methyl-5-(1,1,3,3,3-pentafluoropropyl)pyrazine.
| Compound Name | 2-methyl-5-(1,1,3,3,3-pentafluoropropyl)pyrazine |
|---|---|
| PubChem CID | 70343798 |
| Molecular Formula | C8H7F5N2 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-methyl-5-(1,1,3,3,3-pentafluoropropyl)pyrazine |
| SMILES | Cc1cnc(C(F)(F)CC(F)(F)F)cn1 |
| InChI | InChI=1S/C8H7F5N2/c1-5-2-15-6(3-14-5)7(9,10)4-8(11,12)13/h2-3H,4H2,1H3 |
| InChIKey | CRTNDKRFQBUCED-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |