C26H23N3O2S — CID 70343806
2,4-dimethyl-N-[4-(6-thia-1,8-diazatricyclo[8.3.0.03,7]trideca-3(7),4,10,12-tetraene-8-carbonyl)phenyl]benzamide (PubChem CID 70343806) has the molecular formula C26H23N3O2S and a molecular weight of 441.56 g/mol. Its IUPAC name is 2,4-dimethyl-N-[4-(6-thia-1,8-diazatricyclo[8.3.0.03,7]trideca-3(7),4,10,12-tetraene-8-carbonyl)phenyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[4-(6-thia-1,8-diazatricyclo[8.3.0.03,7]trideca-3(7),4,10,12-tetraene-8-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 70343806 |
| Molecular Formula | C26H23N3O2S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2,4-dimethyl-N-[4-(6-thia-1,8-diazatricyclo[8.3.0.03,7]trideca-3(7),4,10,12-tetraene-8-carbonyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(=O)N3Cc4cccn4Cc4ccsc43)cc2)c(C)c1 |
| InChI | InChI=1S/C26H23N3O2S/c1-17-5-10-23(18(2)14-17)24(30)27-21-8-6-19(7-9-21)25(31)29-16-22-4-3-12-28(22)15-20-11-13-32-26(20)29/h3-14H,15-16H2,1-2H3,(H,27,30) |
| InChIKey | XAASYAROFLGSTM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |