C20H25NO — CID 70343815
N-cyclopropyl-2-ethyldispiro[3.2.57.24]tetradeca-5,8,11,13-tetraene-2-carboxamide (PubChem CID 70343815) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is N-cyclopropyl-2-ethyldispiro[3.2.57.24]tetradeca-5,8,11,13-tetraene-2-carboxamide.
| Compound Name | N-cyclopropyl-2-ethyldispiro[3.2.57.24]tetradeca-5,8,11,13-tetraene-2-carboxamide |
|---|---|
| PubChem CID | 70343815 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-cyclopropyl-2-ethyldispiro[3.2.57.24]tetradeca-5,8,11,13-tetraene-2-carboxamide |
| SMILES | CCC1(C(=O)NC2CC2)CC2(C=CC3(C=CCC=C3)C=C2)C1 |
| InChI | InChI=1S/C20H25NO/c1-2-20(17(22)21-16-6-7-16)14-19(15-20)12-10-18(11-13-19)8-4-3-5-9-18/h4-5,8-13,16H,2-3,6-7,14-15H2,1H3,(H,21,22) |
| InChIKey | NHQAQLNMDDAJGU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|