C9H9F5N2 — CID 70343816
2-methyl-5-(1,1,4,4,4-pentafluorobutyl)pyrazine (PubChem CID 70343816) has the molecular formula C9H9F5N2 and a molecular weight of 240.17 g/mol. Its IUPAC name is 2-methyl-5-(1,1,4,4,4-pentafluorobutyl)pyrazine.
| Compound Name | 2-methyl-5-(1,1,4,4,4-pentafluorobutyl)pyrazine |
|---|---|
| PubChem CID | 70343816 |
| Molecular Formula | C9H9F5N2 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-methyl-5-(1,1,4,4,4-pentafluorobutyl)pyrazine |
| SMILES | Cc1cnc(C(F)(F)CCC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H9F5N2/c1-6-4-16-7(5-15-6)8(10,11)2-3-9(12,13)14/h4-5H,2-3H2,1H3 |
| InChIKey | WIPYWQIQUZCOND-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |