C34H42N2O6S — CID 70344081
[1-[1-[(4-butoxyphenyl)methyl]piperidin-4-yl]piperidin-4-yl]-[4-(3,4-dihydroxyphenyl)sulfonylphenyl]methanone (PubChem CID 70344081) has the molecular formula C34H42N2O6S and a molecular weight of 606.79 g/mol. Its IUPAC name is [1-[1-[(4-butoxyphenyl)methyl]piperidin-4-yl]piperidin-4-yl]-[4-(3,4-dihydroxyphenyl)sulfonylphenyl]methanone.
| Compound Name | [1-[1-[(4-butoxyphenyl)methyl]piperidin-4-yl]piperidin-4-yl]-[4-(3,4-dihydroxyphenyl)sulfonylphenyl]methanone |
|---|---|
| PubChem CID | 70344081 |
| Molecular Formula | C34H42N2O6S |
| Molecular Weight | 606.79 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | [1-[1-[(4-butoxyphenyl)methyl]piperidin-4-yl]piperidin-4-yl]-[4-(3,4-dihydroxyphenyl)sulfonylphenyl]methanone |
| SMILES | CCCCOc1ccc(CN2CCC(N3CCC(C(=O)c4ccc(S(=O)(=O)c5ccc(O)c(O)c5)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C34H42N2O6S/c1-2-3-22-42-29-8-4-25(5-9-29)24-35-18-16-28(17-19-35)36-20-14-27(15-21-36)34(39)26-6-10-30(11-7-26)43(40,41)31-12-13-32(37)33(38)23-31/h4-13,23,27-28,37-38H,2-3,14-22,24H2,1H3 |
| InChIKey | WOGTZUKJJRHWBA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.79 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|