C16H14FN3O3S — CID 70344387
methyl (Z)-2-[2-(4-fluorophenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]-3-methoxyprop-2-enoate (PubChem CID 70344387) has the molecular formula C16H14FN3O3S and a molecular weight of 347.37 g/mol. Its IUPAC name is methyl (Z)-2-[2-(4-fluorophenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (Z)-2-[2-(4-fluorophenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 70344387 |
| Molecular Formula | C16H14FN3O3S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | methyl (Z)-2-[2-(4-fluorophenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1sc2nc(-c3ccc(F)cc3)nn2c1C |
| InChI | InChI=1S/C16H14FN3O3S/c1-9-13(12(8-22-2)15(21)23-3)24-16-18-14(19-20(9)16)10-4-6-11(17)7-5-10/h4-8H,1-3H3/b12-8+ |
| InChIKey | XYMUGWAZJPFTMG-XYOKQWHBSA-N |
| XLogP | 3.07 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|