C13H19F6N6O+ — CID 7034441
4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-4-ium-1-yl-N-propyl-1,3,5-triazin-2-amine (PubChem CID 7034441) has the molecular formula C13H19F6N6O+ and a molecular weight of 389.32 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-4-ium-1-yl-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-4-ium-1-yl-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 7034441 |
| Molecular Formula | C13H19F6N6O+ |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-4-ium-1-yl-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCNc1nc(OC(C(F)(F)F)C(F)(F)F)nc(N2CC[NH2+]CC2)n1 |
| InChI | InChI=1S/C13H18F6N6O/c1-2-3-21-9-22-10(25-6-4-20-5-7-25)24-11(23-9)26-8(12(14,15)16)13(17,18)19/h8,20H,2-7H2,1H3,(H,21,22,23,24)/p+1 |
| InChIKey | DLZHRNPRMVGEIY-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |