About 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole
2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole (PubChem CID 70344468) has the molecular formula C19H25BrN4
and a molecular weight of 389.34 g/mol. Its IUPAC name is 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole.
Molecular Properties
| Compound Name | 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole |
| PubChem CID | 70344468 |
| Molecular Formula | C19H25BrN4 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole |
| SMILES | CCCCn1c(CC)nc2nn(-c3ccc(Br)cc3CC)c(C)c21 |
| InChI | InChI=1S/C19H25BrN4/c1-5-8-11-23-17(7-3)21-19-18(23)13(4)24(22-19)16-10-9-15(20)12-14(16)6-2/h9-10,12H,5-8,11H2,1-4H3 |
| InChIKey | OTZMXMNNGYYDCU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole?
The IUPAC name of 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole (CID 70344468) is 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole.
What is the SMILES notation for 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole?
The canonical SMILES for 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole is CCCCn1c(CC)nc2nn(-c3ccc(Br)cc3CC)c(C)c21.
What is the InChIKey of 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole?
The InChIKey is OTZMXMNNGYYDCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25BrN4/c1-5-8-11-23-17(7-3)21-19-18(23)13(4)24(22-19)16-10-9-15(20)12-14(16)6-2/h9-10,12H,5-8,11H2,1-4H3.
What are the key properties of 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole?
2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole has a molecular weight of 389.34 g/mol, XLogP of 5.22, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-2-ethylphenyl)-4-butyl-5-ethyl-3-methylimidazo[4,5-c]pyrazole is sourced from PubChem (CID 70344468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).