About (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate
(4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate (PubChem CID 70344947) has the molecular formula C15H14ClN3O2
and a molecular weight of 303.75 g/mol. Its IUPAC name is (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate |
| PubChem CID | 70344947 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate |
| SMILES | Nc1ccccc1C=NNC(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClN3O2/c16-13-7-5-11(6-8-13)10-21-15(20)19-18-9-12-3-1-2-4-14(12)17/h1-9H,10,17H2,(H,19,20) |
| InChIKey | HZWDUOSMPRRIAX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate?
The IUPAC name of (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate (CID 70344947) is (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate.
What is the SMILES notation for (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate?
The canonical SMILES for (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate is Nc1ccccc1C=NNC(=O)OCc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate?
The InChIKey is HZWDUOSMPRRIAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN3O2/c16-13-7-5-11(6-8-13)10-21-15(20)19-18-9-12-3-1-2-4-14(12)17/h1-9H,10,17H2,(H,19,20).
What are the key properties of (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate?
(4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate has a molecular weight of 303.75 g/mol, XLogP of 3.18, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl N-[(2-aminophenyl)methylideneamino]carbamate is sourced from PubChem (CID 70344947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).