C16H16Cl2N4O — CID 70345082
4-[[6-(3,4-dichloroanilino)pyrimidin-4-yl]amino]cyclohexan-1-one (PubChem CID 70345082) has the molecular formula C16H16Cl2N4O and a molecular weight of 351.24 g/mol. Its IUPAC name is 4-[[6-(3,4-dichloroanilino)pyrimidin-4-yl]amino]cyclohexan-1-one.
| Compound Name | 4-[[6-(3,4-dichloroanilino)pyrimidin-4-yl]amino]cyclohexan-1-one |
|---|---|
| PubChem CID | 70345082 |
| Molecular Formula | C16H16Cl2N4O |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 4-[[6-(3,4-dichloroanilino)pyrimidin-4-yl]amino]cyclohexan-1-one |
| SMILES | O=C1CCC(Nc2cc(Nc3ccc(Cl)c(Cl)c3)ncn2)CC1 |
| InChI | InChI=1S/C16H16Cl2N4O/c17-13-6-3-11(7-14(13)18)22-16-8-15(19-9-20-16)21-10-1-4-12(23)5-2-10/h3,6-10H,1-2,4-5H2,(H2,19,20,21,22) |
| InChIKey | KLEOGDOUVKBNCG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |