About (4-amino-3-methylphenyl) butanoate
(4-amino-3-methylphenyl) butanoate (PubChem CID 70345434) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is (4-amino-3-methylphenyl) butanoate.
Molecular Properties
| Compound Name | (4-amino-3-methylphenyl) butanoate |
| PubChem CID | 70345434 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (4-amino-3-methylphenyl) butanoate |
| SMILES | CCCC(=O)Oc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C11H15NO2/c1-3-4-11(13)14-9-5-6-10(12)8(2)7-9/h5-7H,3-4,12H2,1-2H3 |
| InChIKey | KBFPOHVCQTXKMH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-3-methylphenyl) butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-3-methylphenyl) butanoate?
The IUPAC name of (4-amino-3-methylphenyl) butanoate (CID 70345434) is (4-amino-3-methylphenyl) butanoate.
What is the SMILES notation for (4-amino-3-methylphenyl) butanoate?
The canonical SMILES for (4-amino-3-methylphenyl) butanoate is CCCC(=O)Oc1ccc(N)c(C)c1.
What is the InChIKey of (4-amino-3-methylphenyl) butanoate?
The InChIKey is KBFPOHVCQTXKMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-3-4-11(13)14-9-5-6-10(12)8(2)7-9/h5-7H,3-4,12H2,1-2H3.
What are the key properties of (4-amino-3-methylphenyl) butanoate?
(4-amino-3-methylphenyl) butanoate has a molecular weight of 193.25 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-3-methylphenyl) butanoate is sourced from PubChem (CID 70345434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).