About 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate
1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate (PubChem CID 70345811) has the molecular formula C18H22O6
and a molecular weight of 334.37 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate |
| PubChem CID | 70345811 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)OCC1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C18H22O6/c1-13(19)23-16-8-4-3-7-15(16)17(20)21-11-14-12-22-18(24-14)9-5-2-6-10-18/h3-4,7-8,14H,2,5-6,9-12H2,1H3 |
| InChIKey | SFDJPJDAECSNJF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate?
The IUPAC name of 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate (CID 70345811) is 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate.
What is the SMILES notation for 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate?
The canonical SMILES for 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate is CC(=O)Oc1ccccc1C(=O)OCC1COC2(CCCCC2)O1.
What is the InChIKey of 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate?
The InChIKey is SFDJPJDAECSNJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O6/c1-13(19)23-16-8-4-3-7-15(16)17(20)21-11-14-12-22-18(24-14)9-5-2-6-10-18/h3-4,7-8,14H,2,5-6,9-12H2,1H3.
What are the key properties of 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate?
1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate has a molecular weight of 334.37 g/mol, XLogP of 2.84, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxaspiro[4.5]decan-3-ylmethyl 2-acetyloxybenzoate is sourced from PubChem (CID 70345811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).