About 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one
5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one (PubChem CID 70345928) has the molecular formula C13H15FN2O2
and a molecular weight of 250.27 g/mol. Its IUPAC name is 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one |
| PubChem CID | 70345928 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one |
| SMILES | CN1C(=O)C2(CCN(O)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C13H15FN2O2/c1-15-11-3-2-9(14)8-10(11)13(12(15)17)4-6-16(18)7-5-13/h2-3,8,18H,4-7H2,1H3 |
| InChIKey | WMTRHJKNUXOZPH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one?
The IUPAC name of 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one (CID 70345928) is 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one.
What is the SMILES notation for 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one?
The canonical SMILES for 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one is CN1C(=O)C2(CCN(O)CC2)c2cc(F)ccc21.
What is the InChIKey of 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one?
The InChIKey is WMTRHJKNUXOZPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2O2/c1-15-11-3-2-9(14)8-10(11)13(12(15)17)4-6-16(18)7-5-13/h2-3,8,18H,4-7H2,1H3.
What are the key properties of 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one?
5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one has a molecular weight of 250.27 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1'-hydroxy-1-methylspiro[indole-3,4'-piperidine]-2-one is sourced from PubChem (CID 70345928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).