About 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine
1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine (PubChem CID 70346186) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine |
| PubChem CID | 70346186 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine |
| SMILES | C1=CCN(c2ccoc3cccc2-3)CC1 |
| InChI | InChI=1S/C13H13NO/c1-2-8-14(9-3-1)12-7-10-15-13-6-4-5-11(12)13/h1-2,4-7,10H,3,8-9H2 |
| InChIKey | OIFTWXSHKJPRGM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine (CID 70346186) is 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine is C1=CCN(c2ccoc3cccc2-3)CC1.
What is the InChIKey of 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine?
The InChIKey is OIFTWXSHKJPRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO/c1-2-8-14(9-3-1)12-7-10-15-13-6-4-5-11(12)13/h1-2,4-7,10H,3,8-9H2.
What are the key properties of 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine?
1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine has a molecular weight of 199.25 g/mol, XLogP of 3.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta[b]pyran-4-yl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 70346186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).