C9H13N — CID 70346627
1-methyl-2,3,6,7-tetrahydroindole (PubChem CID 70346627) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 1-methyl-2,3,6,7-tetrahydroindole.
| Compound Name | 1-methyl-2,3,6,7-tetrahydroindole |
|---|---|
| PubChem CID | 70346627 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 1-methyl-2,3,6,7-tetrahydroindole |
| SMILES | CN1CCC2=C1CCC=C2 |
| InChI | InChI=1S/C9H13N/c1-10-7-6-8-4-2-3-5-9(8)10/h2,4H,3,5-7H2,1H3 |
| InChIKey | ROAOLVFPXPWODN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |