C34H25N3O6 — CID 70346877
(18S)-23-hydroxy-10-methoxy-4-[(4-methoxyphenyl)methyl]-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8(13),9,11,20(25),21,23,26-nonaene-3,5,16-trione (PubChem CID 70346877) has the molecular formula C34H25N3O6 and a molecular weight of 571.59 g/mol. Its IUPAC name is (18S)-23-hydroxy-10-methoxy-4-[(4-methoxyphenyl)methyl]-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8(13),9,11,20(25),21,23,26-nonaene-3,5,16-trione.
| Compound Name | (18S)-23-hydroxy-10-methoxy-4-[(4-methoxyphenyl)methyl]-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8(13),9,11,20(25),21,23,26-nonaene-3,5,16-trione |
|---|---|
| PubChem CID | 70346877 |
| Molecular Formula | C34H25N3O6 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | (18S)-23-hydroxy-10-methoxy-4-[(4-methoxyphenyl)methyl]-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8(13),9,11,20(25),21,23,26-nonaene-3,5,16-trione |
| SMILES | COc1ccc(CN2C(=O)c3c(c4c5cc(O)ccc5n5c4c4c3c3cc(OC)ccc3n4C3C[C@H]5CC3=O)C2=O)cc1 |
| InChI | InChI=1S/C34H25N3O6/c1-42-19-6-3-16(4-7-19)15-35-33(40)29-27-21-13-18(38)5-9-23(21)36-17-11-25(26(39)12-17)37-24-10-8-20(43-2)14-22(24)28(30(29)34(35)41)32(37)31(27)36/h3-10,13-14,17,25,38H,11-12,15H2,1-2H3/t17-,25?/m0/s1 |
| InChIKey | DYBROWBEGKHNGQ-LFUZPPSTSA-N |
| XLogP | 5.88 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|