About 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol
2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol (PubChem CID 70347094) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol |
| PubChem CID | 70347094 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol |
| SMILES | Cc1c(CCO)[nH]c2ncccc12 |
| InChI | InChI=1S/C10H12N2O/c1-7-8-3-2-5-11-10(8)12-9(7)4-6-13/h2-3,5,13H,4,6H2,1H3,(H,11,12) |
| InChIKey | HZZRXHWHUNEHCG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol?
The IUPAC name of 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol (CID 70347094) is 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol.
What is the SMILES notation for 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol?
The canonical SMILES for 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol is Cc1c(CCO)[nH]c2ncccc12.
What is the InChIKey of 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol?
The InChIKey is HZZRXHWHUNEHCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-7-8-3-2-5-11-10(8)12-9(7)4-6-13/h2-3,5,13H,4,6H2,1H3,(H,11,12).
What are the key properties of 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol?
2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol has a molecular weight of 176.22 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)ethanol is sourced from PubChem (CID 70347094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).