C9H4N7O4- — CID 7034728
6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 7034728) has the molecular formula C9H4N7O4- and a molecular weight of 274.18 g/mol. Its IUPAC name is 6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | 6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 7034728 |
| Molecular Formula | C9H4N7O4- |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | O=C([O-])c1nc2ncc(-n3cc([N+](=O)[O-])cn3)cn2n1 |
| InChI | InChI=1S/C9H5N7O4/c17-8(18)7-12-9-10-1-5(3-15(9)13-7)14-4-6(2-11-14)16(19)20/h1-4H,(H,17,18)/p-1 |
| InChIKey | NBGMDPKWWSRFIK-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 144.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|