C21H30OSi2 — CID 70347580
6,6-dibenzyl-2,2,3,3-tetramethyloxadisilinane (PubChem CID 70347580) has the molecular formula C21H30OSi2 and a molecular weight of 354.64 g/mol. Its IUPAC name is 6,6-dibenzyl-2,2,3,3-tetramethyloxadisilinane.
| Compound Name | 6,6-dibenzyl-2,2,3,3-tetramethyloxadisilinane |
|---|---|
| PubChem CID | 70347580 |
| Molecular Formula | C21H30OSi2 |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 6,6-dibenzyl-2,2,3,3-tetramethyloxadisilinane |
| SMILES | C[Si]1(C)CCC(Cc2ccccc2)(Cc2ccccc2)O[Si]1(C)C |
| InChI | InChI=1S/C21H30OSi2/c1-23(2)16-15-21(22-24(23,3)4,17-19-11-7-5-8-12-19)18-20-13-9-6-10-14-20/h5-14H,15-18H2,1-4H3 |
| InChIKey | KWUDSIRHFJPIFF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|