C24H30O5 — CID 70347587
[[(8R,9S,13S,14S)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-13-yl]-propanoyloxymethyl] propanoate (PubChem CID 70347587) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is [[(8R,9S,13S,14S)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-13-yl]-propanoyloxymethyl] propanoate.
| Compound Name | [[(8R,9S,13S,14S)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-13-yl]-propanoyloxymethyl] propanoate |
|---|---|
| PubChem CID | 70347587 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [[(8R,9S,13S,14S)-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-13-yl]-propanoyloxymethyl] propanoate |
| SMILES | CCC(=O)OC(OC(=O)CC)[C@]12CC[C@@H]3c4ccccc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H30O5/c1-3-21(26)28-23(29-22(27)4-2)24-14-13-17-16-8-6-5-7-15(16)9-10-18(17)19(24)11-12-20(24)25/h5-8,17-19,23H,3-4,9-14H2,1-2H3/t17-,18-,19+,24-/m1/s1 |
| InChIKey | FLOZYYPVACJYPR-FLFXDLLNSA-N |
| XLogP | 4.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|