C15H21BrO — CID 70347935
2-(2-bromoethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromene (PubChem CID 70347935) has the molecular formula C15H21BrO and a molecular weight of 297.24 g/mol. Its IUPAC name is 2-(2-bromoethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromene.
| Compound Name | 2-(2-bromoethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 70347935 |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-(2-bromoethyl)-2,5,7,8-tetramethyl-3,4-dihydrochromene |
| SMILES | Cc1cc(C)c2c(c1C)OC(C)(CCBr)CC2 |
| InChI | InChI=1S/C15H21BrO/c1-10-9-11(2)13-5-6-15(4,7-8-16)17-14(13)12(10)3/h9H,5-8H2,1-4H3 |
| InChIKey | NLFHURGLSMGMOA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|