About 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole
3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole (PubChem CID 70348156) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole.
Molecular Properties
| Compound Name | 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole |
| PubChem CID | 70348156 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole |
| SMILES | Cc1c(C(C)C)[nH]c(C(C)C)c1C |
| InChI | InChI=1S/C12H21N/c1-7(2)11-9(5)10(6)12(13-11)8(3)4/h7-8,13H,1-6H3 |
| InChIKey | KKDZAEKJJRIDAS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole?
The IUPAC name of 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole (CID 70348156) is 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole.
What is the SMILES notation for 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole?
The canonical SMILES for 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole is Cc1c(C(C)C)[nH]c(C(C)C)c1C.
What is the InChIKey of 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole?
The InChIKey is KKDZAEKJJRIDAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-7(2)11-9(5)10(6)12(13-11)8(3)4/h7-8,13H,1-6H3.
What are the key properties of 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole?
3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole has a molecular weight of 179.31 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2,5-di(propan-2-yl)-1H-pyrrole is sourced from PubChem (CID 70348156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).