C34H62N8O4 — CID 70348515
1-[(4-hexylpiperazin-1-yl)methyl]-4-[3-[4-[(4-hexylpiperazin-1-yl)methyl]-3,5-dioxopiperazin-1-yl]butan-2-yl]piperazine-2,6-dione (PubChem CID 70348515) has the molecular formula C34H62N8O4 and a molecular weight of 646.92 g/mol. Its IUPAC name is 1-[(4-hexylpiperazin-1-yl)methyl]-4-[3-[4-[(4-hexylpiperazin-1-yl)methyl]-3,5-dioxopiperazin-1-yl]butan-2-yl]piperazine-2,6-dione.
| Compound Name | 1-[(4-hexylpiperazin-1-yl)methyl]-4-[3-[4-[(4-hexylpiperazin-1-yl)methyl]-3,5-dioxopiperazin-1-yl]butan-2-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 70348515 |
| Molecular Formula | C34H62N8O4 |
| Molecular Weight | 646.92 g/mol |
| Exact Mass | 646.49 |
| IUPAC Name | 1-[(4-hexylpiperazin-1-yl)methyl]-4-[3-[4-[(4-hexylpiperazin-1-yl)methyl]-3,5-dioxopiperazin-1-yl]butan-2-yl]piperazine-2,6-dione |
| SMILES | CCCCCCN1CCN(CN2C(=O)CN(C(C)C(C)N3CC(=O)N(CN4CCN(CCCCCC)CC4)C(=O)C3)CC2=O)CC1 |
| InChI | InChI=1S/C34H62N8O4/c1-5-7-9-11-13-35-15-19-37(20-16-35)27-41-31(43)23-39(24-32(41)44)29(3)30(4)40-25-33(45)42(34(46)26-40)28-38-21-17-36(18-22-38)14-12-10-8-6-2/h29-30H,5-28H2,1-4H3 |
| InChIKey | WLHXEBHJIVFYTE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 94.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.92 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|