C20H25BrO2 — CID 70348799
(8S,13S,14S,17S)-17-(bromomethyl)-13-ethyl-17-hydroxy-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70348799) has the molecular formula C20H25BrO2 and a molecular weight of 377.32 g/mol. Its IUPAC name is (8S,13S,14S,17S)-17-(bromomethyl)-13-ethyl-17-hydroxy-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13S,14S,17S)-17-(bromomethyl)-13-ethyl-17-hydroxy-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70348799 |
| Molecular Formula | C20H25BrO2 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (8S,13S,14S,17S)-17-(bromomethyl)-13-ethyl-17-hydroxy-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@]12C=CC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)CBr |
| InChI | InChI=1S/C20H25BrO2/c1-2-19-9-7-16-15-6-4-14(22)11-13(15)3-5-17(16)18(19)8-10-20(19,23)12-21/h7,9,11,17-18,23H,2-6,8,10,12H2,1H3/t17-,18+,19+,20-/m1/s1 |
| InChIKey | QCIPJEKJQIWECN-FUMNGEBKSA-N |
| XLogP | 4.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|