About 1H-imidazole;2-methylbenzenethiol;zinc
1H-imidazole;2-methylbenzenethiol;zinc (PubChem CID 70348825) has the molecular formula C10H12N2SZn
and a molecular weight of 257.68 g/mol. Its IUPAC name is 1H-imidazole;2-methylbenzenethiol;zinc.
Molecular Properties
| Compound Name | 1H-imidazole;2-methylbenzenethiol;zinc |
| PubChem CID | 70348825 |
| Molecular Formula | C10H12N2SZn |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 1H-imidazole;2-methylbenzenethiol;zinc |
| SMILES | Cc1ccccc1S.[Zn].c1c[nH]cn1 |
| InChI | InChI=1S/C7H8S.C3H4N2.Zn/c1-6-4-2-3-5-7(6)8;1-2-5-3-4-1;/h2-5,8H,1H3;1-3H,(H,4,5); |
| InChIKey | LWKKCFMBNCPECD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazole;2-methylbenzenethiol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;2-methylbenzenethiol;zinc?
The IUPAC name of 1H-imidazole;2-methylbenzenethiol;zinc (CID 70348825) is 1H-imidazole;2-methylbenzenethiol;zinc.
What is the SMILES notation for 1H-imidazole;2-methylbenzenethiol;zinc?
The canonical SMILES for 1H-imidazole;2-methylbenzenethiol;zinc is Cc1ccccc1S.[Zn].c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;2-methylbenzenethiol;zinc?
The InChIKey is LWKKCFMBNCPECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S.C3H4N2.Zn/c1-6-4-2-3-5-7(6)8;1-2-5-3-4-1;/h2-5,8H,1H3;1-3H,(H,4,5);.
What are the key properties of 1H-imidazole;2-methylbenzenethiol;zinc?
1H-imidazole;2-methylbenzenethiol;zinc has a molecular weight of 257.68 g/mol, XLogP of 2.69, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;2-methylbenzenethiol;zinc is sourced from PubChem (CID 70348825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).