C33H46N2O6 — CID 70348847
5-ethyl-N'-[3-(hydroxymethyl)-5-methoxy-4-methylbenzoyl]-N'-[(E)-2,2,5,6,6-pentamethylhept-4-en-3-yl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 70348847) has the molecular formula C33H46N2O6 and a molecular weight of 566.74 g/mol. Its IUPAC name is 5-ethyl-N'-[3-(hydroxymethyl)-5-methoxy-4-methylbenzoyl]-N'-[(E)-2,2,5,6,6-pentamethylhept-4-en-3-yl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | 5-ethyl-N'-[3-(hydroxymethyl)-5-methoxy-4-methylbenzoyl]-N'-[(E)-2,2,5,6,6-pentamethylhept-4-en-3-yl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 70348847 |
| Molecular Formula | C33H46N2O6 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | 5-ethyl-N'-[3-(hydroxymethyl)-5-methoxy-4-methylbenzoyl]-N'-[(E)-2,2,5,6,6-pentamethylhept-4-en-3-yl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | CCc1c(C(=O)NN(C(=O)c2cc(CO)c(C)c(OC)c2)C(/C=C(\C)C(C)(C)C)C(C)(C)C)ccc2c1OCCO2 |
| InChI | InChI=1S/C33H46N2O6/c1-11-24-25(12-13-26-29(24)41-15-14-40-26)30(37)34-35(28(33(7,8)9)16-20(2)32(4,5)6)31(38)22-17-23(19-36)21(3)27(18-22)39-10/h12-13,16-18,28,36H,11,14-15,19H2,1-10H3,(H,34,37)/b20-16+ |
| InChIKey | NEORQQKUPZAVSC-CAPFRKAQSA-N |
| XLogP | 6.02 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|