C9H18N4O4+2 — CID 7034891
3,7-dimethyl-1,5-dinitro-3,7-diazoniabicyclo[3.3.1]nonane (PubChem CID 7034891) has the molecular formula C9H18N4O4+2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3,7-dimethyl-1,5-dinitro-3,7-diazoniabicyclo[3.3.1]nonane.
| Compound Name | 3,7-dimethyl-1,5-dinitro-3,7-diazoniabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 7034891 |
| Molecular Formula | C9H18N4O4+2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 3,7-dimethyl-1,5-dinitro-3,7-diazoniabicyclo[3.3.1]nonane |
| SMILES | C[NH+]1CC2([N+](=O)[O-])C[NH+](C)CC([N+](=O)[O-])(C1)C2 |
| InChI | InChI=1S/C9H16N4O4/c1-10-4-8(12(14)15)3-9(5-10,13(16)17)7-11(2)6-8/h3-7H2,1-2H3/p+2 |
| InChIKey | XNLABIJSWHXLRJ-UHFFFAOYSA-P |
| XLogP | -3.54 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|