C27H33ClO3 — CID 70349948
(8S,11R,13S,14S,17S)-11-(4-chlorophenyl)-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70349948) has the molecular formula C27H33ClO3 and a molecular weight of 441.01 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(4-chlorophenyl)-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-(4-chlorophenyl)-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70349948 |
| Molecular Formula | C27H33ClO3 |
| Molecular Weight | 441.01 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(4-chlorophenyl)-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](c3ccc(Cl)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@]2(O)CCCO |
| InChI | InChI=1S/C27H33ClO3/c1-26-16-23(17-3-6-19(28)7-4-17)25-21-10-8-20(30)15-18(21)5-9-22(25)24(26)11-13-27(26,31)12-2-14-29/h3-4,6-7,15,22-24,29,31H,2,5,8-14,16H2,1H3/t22-,23+,24-,26-,27+/m0/s1 |
| InChIKey | OZBBBUFKIFZINT-IHSWJCKASA-N |
| XLogP | 5.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.01 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |