About 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate
3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate (PubChem CID 7035030) has the molecular formula C12H16NO4-
and a molecular weight of 238.26 g/mol. Its IUPAC name is 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate.
Molecular Properties
| Compound Name | 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate |
| PubChem CID | 7035030 |
| Molecular Formula | C12H16NO4- |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate |
| SMILES | CC1(C)CC(=O)C(/C=N/CCC(=O)[O-])C(=O)C1 |
| InChI | InChI=1S/C12H17NO4/c1-12(2)5-9(14)8(10(15)6-12)7-13-4-3-11(16)17/h7-8H,3-6H2,1-2H3,(H,16,17)/p-1/b13-7+ |
| InChIKey | IEAHRRPLYVOSLY-NTUHNPAUSA-M |
| XLogP | -0.23 |
| TPSA | 86.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate?
The IUPAC name of 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate (CID 7035030) is 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate.
What is the SMILES notation for 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate?
The canonical SMILES for 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate is CC1(C)CC(=O)C(/C=N/CCC(=O)[O-])C(=O)C1.
What is the InChIKey of 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate?
The InChIKey is IEAHRRPLYVOSLY-NTUHNPAUSA-M. The full InChI is InChI=1S/C12H17NO4/c1-12(2)5-9(14)8(10(15)6-12)7-13-4-3-11(16)17/h7-8H,3-6H2,1-2H3,(H,16,17)/p-1/b13-7+.
What are the key properties of 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate?
3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate has a molecular weight of 238.26 g/mol, XLogP of -0.23, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propanoate is sourced from PubChem (CID 7035030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).