C21H41NO2 — CID 70350891
4-[[(2S,3S,5S)-3,4,4,5-tetra(propan-2-yl)oxolan-2-yl]methyl]morpholine (PubChem CID 70350891) has the molecular formula C21H41NO2 and a molecular weight of 339.56 g/mol. Its IUPAC name is 4-[[(2S,3S,5S)-3,4,4,5-tetra(propan-2-yl)oxolan-2-yl]methyl]morpholine.
| Compound Name | 4-[[(2S,3S,5S)-3,4,4,5-tetra(propan-2-yl)oxolan-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 70350891 |
| Molecular Formula | C21H41NO2 |
| Molecular Weight | 339.56 g/mol |
| Exact Mass | 339.31 |
| IUPAC Name | 4-[[(2S,3S,5S)-3,4,4,5-tetra(propan-2-yl)oxolan-2-yl]methyl]morpholine |
| SMILES | CC(C)[C@@H]1[C@@H](CN2CCOCC2)O[C@@H](C(C)C)C1(C(C)C)C(C)C |
| InChI | InChI=1S/C21H41NO2/c1-14(2)19-18(13-22-9-11-23-12-10-22)24-20(15(3)4)21(19,16(5)6)17(7)8/h14-20H,9-13H2,1-8H3/t18-,19-,20+/m1/s1 |
| InChIKey | CKRFHEQHBVFTQM-AQNXPRMDSA-N |
| XLogP | 4.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |