C20H22N2O5 — CID 70351318
methyl 2-[carbamoyl-[(2S)-1-ethoxy-1-oxo-3-phenylpropan-2-yl]amino]benzoate (PubChem CID 70351318) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 2-[carbamoyl-[(2S)-1-ethoxy-1-oxo-3-phenylpropan-2-yl]amino]benzoate.
| Compound Name | methyl 2-[carbamoyl-[(2S)-1-ethoxy-1-oxo-3-phenylpropan-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 70351318 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | methyl 2-[carbamoyl-[(2S)-1-ethoxy-1-oxo-3-phenylpropan-2-yl]amino]benzoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)N(C(N)=O)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C20H22N2O5/c1-3-27-19(24)17(13-14-9-5-4-6-10-14)22(20(21)25)16-12-8-7-11-15(16)18(23)26-2/h4-12,17H,3,13H2,1-2H3,(H2,21,25)/t17-/m0/s1 |
| InChIKey | ZHCJOZMTGRMROB-KRWDZBQOSA-N |
| XLogP | 2.53 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |