About tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine
tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine (PubChem CID 70352199) has the molecular formula C19H31IN2O4
and a molecular weight of 478.37 g/mol. Its IUPAC name is tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine.
Molecular Properties
| Compound Name | tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine |
| PubChem CID | 70352199 |
| Molecular Formula | C19H31IN2O4 |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine |
| SMILES | CC(C)(C)OC(=O)CNCC(=O)OC(C)(C)C.Cc1cc(I)cc(C)n1 |
| InChI | InChI=1S/C12H23NO4.C7H8IN/c1-11(2,3)16-9(14)7-13-8-10(15)17-12(4,5)6;1-5-3-7(8)4-6(2)9-5/h13H,7-8H2,1-6H3;3-4H,1-2H3 |
| InChIKey | PPZWBNVREOHFLJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine?
The IUPAC name of tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine (CID 70352199) is tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine.
What is the SMILES notation for tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine?
The canonical SMILES for tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine is CC(C)(C)OC(=O)CNCC(=O)OC(C)(C)C.Cc1cc(I)cc(C)n1.
What is the InChIKey of tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine?
The InChIKey is PPZWBNVREOHFLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO4.C7H8IN/c1-11(2,3)16-9(14)7-13-8-10(15)17-12(4,5)6;1-5-3-7(8)4-6(2)9-5/h13H,7-8H2,1-6H3;3-4H,1-2H3.
What are the key properties of tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine?
tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine has a molecular weight of 478.37 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate;4-iodo-2,6-dimethylpyridine is sourced from PubChem (CID 70352199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).