C23H29N7O — CID 70352248
6-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)piperazin-1-yl]hexan-1-ol (PubChem CID 70352248) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 6-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)piperazin-1-yl]hexan-1-ol.
| Compound Name | 6-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)piperazin-1-yl]hexan-1-ol |
|---|---|
| PubChem CID | 70352248 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 6-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)piperazin-1-yl]hexan-1-ol |
| SMILES | OCCCCCCN1CCN(c2nc(-c3ccccn3)nc(-c3ccccn3)n2)CC1 |
| InChI | InChI=1S/C23H29N7O/c31-18-8-2-1-7-13-29-14-16-30(17-15-29)23-27-21(19-9-3-5-11-24-19)26-22(28-23)20-10-4-6-12-25-20/h3-6,9-12,31H,1-2,7-8,13-18H2 |
| InChIKey | VSLVWYLPBJZQEU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|