About 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate
3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate (PubChem CID 70352465) has the molecular formula C10H10O5
and a molecular weight of 210.19 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate |
| PubChem CID | 70352465 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate |
| SMILES | O=C(O)Oc1cccc2c1OCCCO2 |
| InChI | InChI=1S/C10H10O5/c11-10(12)15-8-4-1-3-7-9(8)14-6-2-5-13-7/h1,3-4H,2,5-6H2,(H,11,12) |
| InChIKey | ZSYXFSOMXWZCCL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate?
The IUPAC name of 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate (CID 70352465) is 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate.
What is the SMILES notation for 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate?
The canonical SMILES for 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate is O=C(O)Oc1cccc2c1OCCCO2.
What is the InChIKey of 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate?
The InChIKey is ZSYXFSOMXWZCCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5/c11-10(12)15-8-4-1-3-7-9(8)14-6-2-5-13-7/h1,3-4H,2,5-6H2,(H,11,12).
What are the key properties of 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate?
3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate has a molecular weight of 210.19 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-1,5-benzodioxepin-6-yl hydrogen carbonate is sourced from PubChem (CID 70352465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).