About tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate
tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate (PubChem CID 70352670) has the molecular formula C22H20FNO4S
and a molecular weight of 413.47 g/mol. Its IUPAC name is tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate.
Molecular Properties
| Compound Name | tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate |
| PubChem CID | 70352670 |
| Molecular Formula | C22H20FNO4S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1cc(-c2cccc(F)c2)c(=O)n2c1-c1sccc1CC2 |
| InChI | InChI=1S/C22H20FNO4S/c1-22(2,3)28-21(26)27-17-12-16(14-5-4-6-15(23)11-14)20(25)24-9-7-13-8-10-29-19(13)18(17)24/h4-6,8,10-12H,7,9H2,1-3H3 |
| InChIKey | JJXUWRIIQNIIRU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate?
The IUPAC name of tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate (CID 70352670) is tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate.
What is the SMILES notation for tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate?
The canonical SMILES for tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate is CC(C)(C)OC(=O)Oc1cc(-c2cccc(F)c2)c(=O)n2c1-c1sccc1CC2.
What is the InChIKey of tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate?
The InChIKey is JJXUWRIIQNIIRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FNO4S/c1-22(2,3)28-21(26)27-17-12-16(14-5-4-6-15(23)11-14)20(25)24-9-7-13-8-10-29-19(13)18(17)24/h4-6,8,10-12H,7,9H2,1-3H3.
What are the key properties of tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate?
tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate has a molecular weight of 413.47 g/mol, XLogP of 5.25, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [8-(3-fluorophenyl)-7-oxo-4,5-dihydrothieno[2,3-a]quinolizin-10-yl] carbonate is sourced from PubChem (CID 70352670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).