About 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one
2-(4-aminophenyl)-1,5-dihydropyridazin-6-one (PubChem CID 70352764) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one.
Molecular Properties
| Compound Name | 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one |
| PubChem CID | 70352764 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one |
| SMILES | Nc1ccc(N2C=CCC(=O)N2)cc1 |
| InChI | InChI=1S/C10H11N3O/c11-8-3-5-9(6-4-8)13-7-1-2-10(14)12-13/h1,3-7H,2,11H2,(H,12,14) |
| InChIKey | PKQJZMYABPYFHM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one?
The IUPAC name of 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one (CID 70352764) is 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one.
What is the SMILES notation for 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one?
The canonical SMILES for 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one is Nc1ccc(N2C=CCC(=O)N2)cc1.
What is the InChIKey of 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one?
The InChIKey is PKQJZMYABPYFHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c11-8-3-5-9(6-4-8)13-7-1-2-10(14)12-13/h1,3-7H,2,11H2,(H,12,14).
What are the key properties of 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one?
2-(4-aminophenyl)-1,5-dihydropyridazin-6-one has a molecular weight of 189.22 g/mol, XLogP of 1.02, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminophenyl)-1,5-dihydropyridazin-6-one is sourced from PubChem (CID 70352764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).