About 2-ethylhexanoic acid;1-ethylpiperidine
2-ethylhexanoic acid;1-ethylpiperidine (PubChem CID 70352845) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is 2-ethylhexanoic acid;1-ethylpiperidine.
Molecular Properties
| Compound Name | 2-ethylhexanoic acid;1-ethylpiperidine |
| PubChem CID | 70352845 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 2-ethylhexanoic acid;1-ethylpiperidine |
| SMILES | CCCCC(CC)C(=O)O.CCN1CCCCC1 |
| InChI | InChI=1S/C8H16O2.C7H15N/c1-3-5-6-7(4-2)8(9)10;1-2-8-6-4-3-5-7-8/h7H,3-6H2,1-2H3,(H,9,10);2-7H2,1H3 |
| InChIKey | AYNMAOFQFXYNPH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylhexanoic acid;1-ethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanoic acid;1-ethylpiperidine?
The IUPAC name of 2-ethylhexanoic acid;1-ethylpiperidine (CID 70352845) is 2-ethylhexanoic acid;1-ethylpiperidine.
What is the SMILES notation for 2-ethylhexanoic acid;1-ethylpiperidine?
The canonical SMILES for 2-ethylhexanoic acid;1-ethylpiperidine is CCCCC(CC)C(=O)O.CCN1CCCCC1.
What is the InChIKey of 2-ethylhexanoic acid;1-ethylpiperidine?
The InChIKey is AYNMAOFQFXYNPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C7H15N/c1-3-5-6-7(4-2)8(9)10;1-2-8-6-4-3-5-7-8/h7H,3-6H2,1-2H3,(H,9,10);2-7H2,1H3.
What are the key properties of 2-ethylhexanoic acid;1-ethylpiperidine?
2-ethylhexanoic acid;1-ethylpiperidine has a molecular weight of 257.42 g/mol, XLogP of 3.78, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanoic acid;1-ethylpiperidine is sourced from PubChem (CID 70352845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).