About 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide
3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide (PubChem CID 70352870) has the molecular formula C13H23Br2N3OS
and a molecular weight of 429.22 g/mol. Its IUPAC name is 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide.
Molecular Properties
| Compound Name | 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide |
| PubChem CID | 70352870 |
| Molecular Formula | C13H23Br2N3OS |
| Molecular Weight | 429.22 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide |
| SMILES | Br.Br.NC1Sc2ccccc2N1CC1CCNCC1.O |
| InChI | InChI=1S/C13H19N3S.2BrH.H2O/c14-13-16(9-10-5-7-15-8-6-10)11-3-1-2-4-12(11)17-13;;;/h1-4,10,13,15H,5-9,14H2;2*1H;1H2 |
| InChIKey | HSVMCUYGNOLVAW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide?
The IUPAC name of 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide (CID 70352870) is 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide.
What is the SMILES notation for 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide?
The canonical SMILES for 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide is Br.Br.NC1Sc2ccccc2N1CC1CCNCC1.O.
What is the InChIKey of 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide?
The InChIKey is HSVMCUYGNOLVAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3S.2BrH.H2O/c14-13-16(9-10-5-7-15-8-6-10)11-3-1-2-4-12(11)17-13;;;/h1-4,10,13,15H,5-9,14H2;2*1H;1H2.
What are the key properties of 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide?
3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide has a molecular weight of 429.22 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(piperidin-4-ylmethyl)-2H-1,3-benzothiazol-2-amine;hydrate;dihydrobromide is sourced from PubChem (CID 70352870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).