About 4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine
4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine (PubChem CID 70353094) has the molecular formula C9H12N2S
and a molecular weight of 180.28 g/mol. Its IUPAC name is 4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine.
Analyze 4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine?
The IUPAC name of 4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine (CID 70353094) is 4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine.
What is the SMILES notation for 4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine?
The canonical SMILES for 4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine is CN1C=CSC2=C(C=CCN2)C1.
What is the InChIKey of 4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine?
The InChIKey is NPJKPBCNPIZDFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S/c1-11-5-6-12-9-8(7-11)3-2-4-10-9/h2-3,5-6,10H,4,7H2,1H3.
What are the key properties of 4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine?
4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine has a molecular weight of 180.28 g/mol, XLogP of 1.51, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-8,9-dihydro-5H-pyrido[3,2-f][1,4]thiazepine is sourced from PubChem (CID 70353094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).