About 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine
4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine (PubChem CID 70353174) has the molecular formula C23H20ClFN2
and a molecular weight of 378.88 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine.
Molecular Properties
| Compound Name | 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine |
| PubChem CID | 70353174 |
| Molecular Formula | C23H20ClFN2 |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine |
| SMILES | Fc1ccc(-c2cc(CN3CC=C(c4ccc(Cl)cc4)CC3)ccn2)cc1 |
| InChI | InChI=1S/C23H20ClFN2/c24-21-5-1-18(2-6-21)19-10-13-27(14-11-19)16-17-9-12-26-23(15-17)20-3-7-22(25)8-4-20/h1-10,12,15H,11,13-14,16H2 |
| InChIKey | GVZULIYCZIZTQE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine?
The IUPAC name of 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine (CID 70353174) is 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine.
What is the SMILES notation for 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine?
The canonical SMILES for 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine is Fc1ccc(-c2cc(CN3CC=C(c4ccc(Cl)cc4)CC3)ccn2)cc1.
What is the InChIKey of 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine?
The InChIKey is GVZULIYCZIZTQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20ClFN2/c24-21-5-1-18(2-6-21)19-10-13-27(14-11-19)16-17-9-12-26-23(15-17)20-3-7-22(25)8-4-20/h1-10,12,15H,11,13-14,16H2.
What are the key properties of 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine?
4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine has a molecular weight of 378.88 g/mol, XLogP of 5.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2-(4-fluorophenyl)pyridine is sourced from PubChem (CID 70353174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).