C28H30N4O4 — CID 70353237
but-2-enedioic acid;N,N,2-trimethyl-3-(6-phenylpyrido[2,3-b][1,4]benzodiazepin-11-yl)propan-1-amine (PubChem CID 70353237) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is but-2-enedioic acid;N,N,2-trimethyl-3-(6-phenylpyrido[2,3-b][1,4]benzodiazepin-11-yl)propan-1-amine.
| Compound Name | but-2-enedioic acid;N,N,2-trimethyl-3-(6-phenylpyrido[2,3-b][1,4]benzodiazepin-11-yl)propan-1-amine |
|---|---|
| PubChem CID | 70353237 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | but-2-enedioic acid;N,N,2-trimethyl-3-(6-phenylpyrido[2,3-b][1,4]benzodiazepin-11-yl)propan-1-amine |
| SMILES | CC(CN(C)C)CN1c2ccccc2C(c2ccccc2)=Nc2cccnc21.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C24H26N4.C4H4O4/c1-18(16-27(2)3)17-28-22-14-8-7-12-20(22)23(19-10-5-4-6-11-19)26-21-13-9-15-25-24(21)28;5-3(6)1-2-4(7)8/h4-15,18H,16-17H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | PMJGFJMYYOUKRK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|