About 4-imino-5H-isoindole-1,3-dione;hydrochloride
4-imino-5H-isoindole-1,3-dione;hydrochloride (PubChem CID 70353345) has the molecular formula C8H7ClN2O2
and a molecular weight of 198.61 g/mol. Its IUPAC name is 4-imino-5H-isoindole-1,3-dione;hydrochloride.
Molecular Properties
| Compound Name | 4-imino-5H-isoindole-1,3-dione;hydrochloride |
| PubChem CID | 70353345 |
| Molecular Formula | C8H7ClN2O2 |
| Molecular Weight | 198.61 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 4-imino-5H-isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.[H]/N=C1\CC=CC2=C1C(=O)NC2=O |
| InChI | InChI=1S/C8H6N2O2.ClH/c9-5-3-1-2-4-6(5)8(12)10-7(4)11;/h1-2,9H,3H2,(H,10,11,12);1H/b9-5+; |
| InChIKey | PPRPKFVCKWQDRA-SZKNIZGXSA-N |
| XLogP | 0.34 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.61 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-imino-5H-isoindole-1,3-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-5H-isoindole-1,3-dione;hydrochloride?
The IUPAC name of 4-imino-5H-isoindole-1,3-dione;hydrochloride (CID 70353345) is 4-imino-5H-isoindole-1,3-dione;hydrochloride.
What is the SMILES notation for 4-imino-5H-isoindole-1,3-dione;hydrochloride?
The canonical SMILES for 4-imino-5H-isoindole-1,3-dione;hydrochloride is Cl.[H]/N=C1\CC=CC2=C1C(=O)NC2=O.
What is the InChIKey of 4-imino-5H-isoindole-1,3-dione;hydrochloride?
The InChIKey is PPRPKFVCKWQDRA-SZKNIZGXSA-N. The full InChI is InChI=1S/C8H6N2O2.ClH/c9-5-3-1-2-4-6(5)8(12)10-7(4)11;/h1-2,9H,3H2,(H,10,11,12);1H/b9-5+;.
What are the key properties of 4-imino-5H-isoindole-1,3-dione;hydrochloride?
4-imino-5H-isoindole-1,3-dione;hydrochloride has a molecular weight of 198.61 g/mol, XLogP of 0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-5H-isoindole-1,3-dione;hydrochloride is sourced from PubChem (CID 70353345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).